About N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide
N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide (PubChem CID 129060184) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide.
Molecular Properties
| Compound Name | N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide |
| PubChem CID | 129060184 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide |
| SMILES | CCC(=O)NCC1C=NC(C)=CN1 |
| InChI | InChI=1S/C9H15N3O/c1-3-9(13)12-6-8-5-10-7(2)4-11-8/h4-5,8,11H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | HQKCRYZGJUUUFC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide?
The IUPAC name of N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide (CID 129060184) is N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide.
What is the SMILES notation for N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide?
The canonical SMILES for N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide is CCC(=O)NCC1C=NC(C)=CN1.
What is the InChIKey of N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide?
The InChIKey is HQKCRYZGJUUUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-3-9(13)12-6-8-5-10-7(2)4-11-8/h4-5,8,11H,3,6H2,1-2H3,(H,12,13).
What are the key properties of N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide?
N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide has a molecular weight of 181.24 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1,2-dihydropyrazin-2-yl)methyl]propanamide is sourced from PubChem (CID 129060184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).