About 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine
3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine (PubChem CID 129060323) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine.
Molecular Properties
| Compound Name | 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine |
| PubChem CID | 129060323 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine |
| SMILES | C=C(C)C1=NC=C(N)NC1 |
| InChI | InChI=1S/C7H11N3/c1-5(2)6-3-10-7(8)4-9-6/h4,10H,1,3,8H2,2H3 |
| InChIKey | SKUPDZFNFWTKOC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine?
The IUPAC name of 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine (CID 129060323) is 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine.
What is the SMILES notation for 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine?
The canonical SMILES for 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine is C=C(C)C1=NC=C(N)NC1.
What is the InChIKey of 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine?
The InChIKey is SKUPDZFNFWTKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-5(2)6-3-10-7(8)4-9-6/h4,10H,1,3,8H2,2H3.
What are the key properties of 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine?
3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine has a molecular weight of 137.19 g/mol, XLogP of 0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-en-2-yl-1,2-dihydropyrazin-6-amine is sourced from PubChem (CID 129060323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).