About (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide
(2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide (PubChem CID 129060338) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide.
Molecular Properties
| Compound Name | (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide |
| PubChem CID | 129060338 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide |
| SMILES | CC1(NC(=O)[C@H](N)Cc2c[nH]c3c2=CCCC=3)CC1 |
| InChI | InChI=1S/C15H21N3O/c1-15(6-7-15)18-14(19)12(16)8-10-9-17-13-5-3-2-4-11(10)13/h4-5,9,12,17H,2-3,6-8,16H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | XPGDJLGZZQWXFZ-GFCCVEGCSA-N |
| XLogP | -0.09 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide?
The IUPAC name of (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide (CID 129060338) is (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide.
What is the SMILES notation for (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide?
The canonical SMILES for (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide is CC1(NC(=O)[C@H](N)Cc2c[nH]c3c2=CCCC=3)CC1.
What is the InChIKey of (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide?
The InChIKey is XPGDJLGZZQWXFZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H21N3O/c1-15(6-7-15)18-14(19)12(16)8-10-9-17-13-5-3-2-4-11(10)13/h4-5,9,12,17H,2-3,6-8,16H2,1H3,(H,18,19)/t12-/m1/s1.
What are the key properties of (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide?
(2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide has a molecular weight of 259.35 g/mol, XLogP of -0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(5,6-dihydro-1H-indol-3-yl)-N-(1-methylcyclopropyl)propanamide is sourced from PubChem (CID 129060338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).