C20H29N3S2 — CID 129060416
N-methyl-N-[2-[2-(methylamino)ethyldisulfanyl]ethyl]-4-[(1E,3E,5Z)-7-methyliminohepta-1,3,5-trienyl]aniline (PubChem CID 129060416) has the molecular formula C20H29N3S2 and a molecular weight of 375.61 g/mol. Its IUPAC name is N-methyl-N-[2-[2-(methylamino)ethyldisulfanyl]ethyl]-4-[(1E,3E,5Z)-7-methyliminohepta-1,3,5-trienyl]aniline.
| Compound Name | N-methyl-N-[2-[2-(methylamino)ethyldisulfanyl]ethyl]-4-[(1E,3E,5Z)-7-methyliminohepta-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 129060416 |
| Molecular Formula | C20H29N3S2 |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-methyl-N-[2-[2-(methylamino)ethyldisulfanyl]ethyl]-4-[(1E,3E,5Z)-7-methyliminohepta-1,3,5-trienyl]aniline |
| SMILES | C/N=C/C=C\C=C\C=C\c1ccc(N(C)CCSSCCNC)cc1 |
| InChI | InChI=1S/C20H29N3S2/c1-21-14-8-6-4-5-7-9-19-10-12-20(13-11-19)23(3)16-18-25-24-17-15-22-2/h4-14,22H,15-18H2,1-3H3/b5-4+,8-6-,9-7+,21-14+ |
| InChIKey | KHVWAWBJEBLLID-SGXXOORUSA-N |
| XLogP | 4.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|