About 2-methyl-4,9-dimethylidene-1H-1,3-diazonine
2-methyl-4,9-dimethylidene-1H-1,3-diazonine (PubChem CID 129060640) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-methyl-4,9-dimethylidene-1H-1,3-diazonine.
Molecular Properties
| Compound Name | 2-methyl-4,9-dimethylidene-1H-1,3-diazonine |
| PubChem CID | 129060640 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-methyl-4,9-dimethylidene-1H-1,3-diazonine |
| SMILES | C=c1ccccc(=C)[nH]c(C)n1 |
| InChI | InChI=1S/C10H12N2/c1-8-6-4-5-7-9(2)12-10(3)11-8/h4-7H,1-2H2,3H3,(H,11,12)/b6-4-,7-5- |
| InChIKey | NGMLDHAONKINRY-PEPZGXQESA-N |
| XLogP | 0.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-4,9-dimethylidene-1H-1,3-diazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,9-dimethylidene-1H-1,3-diazonine?
The IUPAC name of 2-methyl-4,9-dimethylidene-1H-1,3-diazonine (CID 129060640) is 2-methyl-4,9-dimethylidene-1H-1,3-diazonine.
What is the SMILES notation for 2-methyl-4,9-dimethylidene-1H-1,3-diazonine?
The canonical SMILES for 2-methyl-4,9-dimethylidene-1H-1,3-diazonine is C=c1ccccc(=C)[nH]c(C)n1.
What is the InChIKey of 2-methyl-4,9-dimethylidene-1H-1,3-diazonine?
The InChIKey is NGMLDHAONKINRY-PEPZGXQESA-N. The full InChI is InChI=1S/C10H12N2/c1-8-6-4-5-7-9(2)12-10(3)11-8/h4-7H,1-2H2,3H3,(H,11,12)/b6-4-,7-5-.
What are the key properties of 2-methyl-4,9-dimethylidene-1H-1,3-diazonine?
2-methyl-4,9-dimethylidene-1H-1,3-diazonine has a molecular weight of 160.22 g/mol, XLogP of 0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,9-dimethylidene-1H-1,3-diazonine is sourced from PubChem (CID 129060640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).