C29H32N6O5 — CID 129060678
[4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-[(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazenyl]phenyl]methanol (PubChem CID 129060678) has the molecular formula C29H32N6O5 and a molecular weight of 544.61 g/mol. Its IUPAC name is [4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-[(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazenyl]phenyl]methanol.
| Compound Name | [4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-[(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazenyl]phenyl]methanol |
|---|---|
| PubChem CID | 129060678 |
| Molecular Formula | C29H32N6O5 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | [4-methoxy-2-[(4-nitrophenyl)diazenyl]-5-[(6-propan-2-yloxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)diazenyl]phenyl]methanol |
| SMILES | COc1cc(/N=N/c2ccc([N+](=O)[O-])cc2)c(CO)cc1/N=N/c1cc2c3c(c1OC(C)C)CCCN3CCC2 |
| InChI | InChI=1S/C29H32N6O5/c1-18(2)40-29-23-7-5-13-34-12-4-6-19(28(23)34)14-26(29)33-32-25-15-20(17-36)24(16-27(25)39-3)31-30-21-8-10-22(11-9-21)35(37)38/h8-11,14-16,18,36H,4-7,12-13,17H2,1-3H3/b31-30+,33-32+ |
| InChIKey | MYUYQMQWQOIZAI-CJQWSLHQSA-N |
| XLogP | 7.41 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|