C19H20F3N7O — CID 129060702
1,1,1,3,3,3-hexadeuterio-2-[dideuterio-[[4-[(2-methyl-4-pyridinyl)amino]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol (PubChem CID 129060702) has the molecular formula C19H20F3N7O and a molecular weight of 427.46 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexadeuterio-2-[dideuterio-[[4-[(2-methyl-4-pyridinyl)amino]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexadeuterio-2-[dideuterio-[[4-[(2-methyl-4-pyridinyl)amino]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol |
|---|---|
| PubChem CID | 129060702 |
| Molecular Formula | C19H20F3N7O |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1,1,1,3,3,3-hexadeuterio-2-[dideuterio-[[4-[(2-methyl-4-pyridinyl)amino]-6-[6-(trifluoromethyl)-2-pyridinyl]-1,3,5-triazin-2-yl]amino]methyl]propan-2-ol |
| SMILES | [2H]C([2H])([2H])C(O)(C([2H])([2H])[2H])C([2H])([2H])Nc1nc(Nc2ccnc(C)c2)nc(-c2cccc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C19H20F3N7O/c1-11-9-12(7-8-23-11)25-17-28-15(27-16(29-17)24-10-18(2,3)30)13-5-4-6-14(26-13)19(20,21)22/h4-9,30H,10H2,1-3H3,(H2,23,24,25,27,28,29)/i2D3,3D3,10D2 |
| InChIKey | AJSDLOIUODHYCU-OKMYGNPYSA-N |
| XLogP | 3.58 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |