C21H24N6O2 — CID 129060788
1-[(3S)-3-[8-(5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]cyclohexyl]prop-2-en-1-one (PubChem CID 129060788) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[(3S)-3-[8-(5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]cyclohexyl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[8-(5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]cyclohexyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129060788 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 1-[(3S)-3-[8-(5,7-dihydro-4H-pyrazolo[1,5-c][1,3]oxazin-2-ylamino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]cyclohexyl]prop-2-en-1-one |
| SMILES | C=CC(=O)C1CCC[C@H](c2cc(Nc3cc4n(n3)COCC4)c3ncnn3c2)C1 |
| InChI | InChI=1S/C21H24N6O2/c1-2-19(28)15-5-3-4-14(8-15)16-9-18(21-22-12-23-26(21)11-16)24-20-10-17-6-7-29-13-27(17)25-20/h2,9-12,14-15H,1,3-8,13H2,(H,24,25)/t14-,15?/m0/s1 |
| InChIKey | APOMQLXABNJUSF-MLCCFXAWSA-N |
| XLogP | 3.23 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|