C6H10O12S4 — CID 129060925
6-methyl-3-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide (PubChem CID 129060925) has the molecular formula C6H10O12S4 and a molecular weight of 402.40 g/mol. Its IUPAC name is 6-methyl-3-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide.
| Compound Name | 6-methyl-3-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide |
|---|---|
| PubChem CID | 129060925 |
| Molecular Formula | C6H10O12S4 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 401.91 |
| IUPAC Name | 6-methyl-3-[(2,2,4,4-tetraoxo-1,5,2,4-dioxadithian-6-yl)methyl]-1,5,2,4-dioxadithiane 2,2,4,4-tetraoxide |
| SMILES | CC1OS(=O)(=O)C(CC2OS(=O)(=O)CS(=O)(=O)O2)S(=O)(=O)O1 |
| InChI | InChI=1S/C6H10O12S4/c1-4-15-21(11,12)6(22(13,14)16-4)2-5-17-19(7,8)3-20(9,10)18-5/h4-6H,2-3H2,1H3 |
| InChIKey | RDAKBBIQJKFYKR-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|