C5H8Cl4N2O — CID 12906099
1,3-dimethyl-1-(1,2,2,2-tetrachloroethyl)urea (PubChem CID 12906099) has the molecular formula C5H8Cl4N2O and a molecular weight of 253.94 g/mol. Its IUPAC name is 1,3-dimethyl-1-(1,2,2,2-tetrachloroethyl)urea.
| Compound Name | 1,3-dimethyl-1-(1,2,2,2-tetrachloroethyl)urea |
|---|---|
| PubChem CID | 12906099 |
| Molecular Formula | C5H8Cl4N2O |
| Molecular Weight | 253.94 g/mol |
| Exact Mass | 251.94 |
| IUPAC Name | 1,3-dimethyl-1-(1,2,2,2-tetrachloroethyl)urea |
| SMILES | CNC(=O)N(C)C(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H8Cl4N2O/c1-10-4(12)11(2)3(6)5(7,8)9/h3H,1-2H3,(H,10,12) |
| InChIKey | YSNOGZAEHQMUNY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.94 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|