About 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole
5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole (PubChem CID 129061175) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole.
Analyze 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole?
The IUPAC name of 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole (CID 129061175) is 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole.
What is the SMILES notation for 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole?
The canonical SMILES for 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole is CC(C)(C)C1CC2=C(CN=C2)C1.
What is the InChIKey of 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole?
The InChIKey is XRWIQEAORIUQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-11(2,3)10-4-8-6-12-7-9(8)5-10/h6,10H,4-5,7H2,1-3H3.
What are the key properties of 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole?
5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole has a molecular weight of 163.26 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrrole is sourced from PubChem (CID 129061175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).