C35H36F6N6 — CID 129061223
N,N-bis(4-pentylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine (PubChem CID 129061223) has the molecular formula C35H36F6N6 and a molecular weight of 654.70 g/mol. Its IUPAC name is N,N-bis(4-pentylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine.
| Compound Name | N,N-bis(4-pentylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 129061223 |
| Molecular Formula | C35H36F6N6 |
| Molecular Weight | 654.70 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | N,N-bis(4-pentylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine |
| SMILES | CCCCCc1ccc(N(c2ccc(CCCCC)cc2)c2cc(-c3cc(C(F)(F)F)[nH]n3)nc(-c3cc(C(F)(F)F)[nH]n3)c2)cc1 |
| InChI | InChI=1S/C35H36F6N6/c1-3-5-7-9-23-11-15-25(16-12-23)47(26-17-13-24(14-18-26)10-8-6-4-2)27-19-28(30-21-32(45-43-30)34(36,37)38)42-29(20-27)31-22-33(46-44-31)35(39,40)41/h11-22H,3-10H2,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | BNVWSHUWHBRDBV-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.70 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|