C20H28N2O2 — CID 129061384
(3Z,5Z)-3-[[2-[[(2Z,3E)-3-hydroxy-2-prop-2-enylidenehexa-3,5-dienyl]amino]ethylamino]methyl]octa-1,3,5,7-tetraen-4-ol (PubChem CID 129061384) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (3Z,5Z)-3-[[2-[[(2Z,3E)-3-hydroxy-2-prop-2-enylidenehexa-3,5-dienyl]amino]ethylamino]methyl]octa-1,3,5,7-tetraen-4-ol.
| Compound Name | (3Z,5Z)-3-[[2-[[(2Z,3E)-3-hydroxy-2-prop-2-enylidenehexa-3,5-dienyl]amino]ethylamino]methyl]octa-1,3,5,7-tetraen-4-ol |
|---|---|
| PubChem CID | 129061384 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3Z,5Z)-3-[[2-[[(2Z,3E)-3-hydroxy-2-prop-2-enylidenehexa-3,5-dienyl]amino]ethylamino]methyl]octa-1,3,5,7-tetraen-4-ol |
| SMILES | C=C/C=C\C(O)=C(/C=C)CNCCNCC(=C/C=C)/C(O)=C\C=C |
| InChI | InChI=1S/C20H28N2O2/c1-5-9-12-20(24)17(8-4)15-21-13-14-22-16-18(10-6-2)19(23)11-7-3/h5-12,21-24H,1-4,13-16H2/b12-9-,18-10-,19-11+,20-17- |
| InChIKey | DHZNIGSOXDUQPK-CNSIQRESSA-N |
| XLogP | 3.65 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|