C20H22F3N3S — CID 129061555
4-(3-hexylthiophen-2-yl)-2-methyl-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 129061555) has the molecular formula C20H22F3N3S and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-(3-hexylthiophen-2-yl)-2-methyl-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
| Compound Name | 4-(3-hexylthiophen-2-yl)-2-methyl-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 129061555 |
| Molecular Formula | C20H22F3N3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-(3-hexylthiophen-2-yl)-2-methyl-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCc1ccsc1-c1cc(C)nc(-c2cc(C(F)(F)F)[nH]n2)c1 |
| InChI | InChI=1S/C20H22F3N3S/c1-3-4-5-6-7-14-8-9-27-19(14)15-10-13(2)24-16(11-15)17-12-18(26-25-17)20(21,22)23/h8-12H,3-7H2,1-2H3,(H,25,26) |
| InChIKey | PJUAEGOBHRDLGU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|