C14H17F3O5S — CID 129061609
2-(1,2,3,4,4a,8a-hexahydronaphthalene-2-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 129061609) has the molecular formula C14H17F3O5S and a molecular weight of 354.35 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,8a-hexahydronaphthalene-2-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 2-(1,2,3,4,4a,8a-hexahydronaphthalene-2-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061609 |
| Molecular Formula | C14H17F3O5S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-(1,2,3,4,4a,8a-hexahydronaphthalene-2-carbonyloxy)-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)C(F)(F)F)C1CCC2C=CC=CC2C1 |
| InChI | InChI=1S/C14H17F3O5S/c15-14(16,17)12(8-23(19,20)21)22-13(18)11-6-5-9-3-1-2-4-10(9)7-11/h1-4,9-12H,5-8H2,(H,19,20,21) |
| InChIKey | NKDJDMRMCMYJIG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|