C16H21F3O5S — CID 129061640
2-[3,5-di(propan-2-yl)benzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 129061640) has the molecular formula C16H21F3O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[3,5-di(propan-2-yl)benzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 2-[3,5-di(propan-2-yl)benzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061640 |
| Molecular Formula | C16H21F3O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-[3,5-di(propan-2-yl)benzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | CC(C)c1cc(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)cc(C(C)C)c1 |
| InChI | InChI=1S/C16H21F3O5S/c1-9(2)11-5-12(10(3)4)7-13(6-11)15(20)24-14(16(17,18)19)8-25(21,22)23/h5-7,9-10,14H,8H2,1-4H3,(H,21,22,23) |
| InChIKey | NCWRHZRMXAOGQL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|