C10H6F6O5S — CID 129061656
3,3,3-trifluoro-2-(2,3,4-trifluorobenzoyl)oxypropane-1-sulfonic acid (PubChem CID 129061656) has the molecular formula C10H6F6O5S and a molecular weight of 352.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(2,3,4-trifluorobenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-(2,3,4-trifluorobenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061656 |
| Molecular Formula | C10H6F6O5S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 3,3,3-trifluoro-2-(2,3,4-trifluorobenzoyl)oxypropane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)C(F)(F)F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H6F6O5S/c11-5-2-1-4(7(12)8(5)13)9(17)21-6(10(14,15)16)3-22(18,19)20/h1-2,6H,3H2,(H,18,19,20) |
| InChIKey | HWBZONIYGJOFBO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|