C14H17F3O5S — CID 129061730
2-(4-tert-butylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 129061730) has the molecular formula C14H17F3O5S and a molecular weight of 354.35 g/mol. Its IUPAC name is 2-(4-tert-butylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 2-(4-tert-butylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129061730 |
| Molecular Formula | C14H17F3O5S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-(4-tert-butylbenzoyl)oxy-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O5S/c1-13(2,3)10-6-4-9(5-7-10)12(18)22-11(14(15,16)17)8-23(19,20)21/h4-7,11H,8H2,1-3H3,(H,19,20,21) |
| InChIKey | BJYVWNIMYFDZMH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|