C25H27ClN6 — CID 129062444
6-[2-(3-chlorophenyl)ethynyl]-N-[(3R)-1-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 129062444) has the molecular formula C25H27ClN6 and a molecular weight of 446.99 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)ethynyl]-N-[(3R)-1-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-[2-(3-chlorophenyl)ethynyl]-N-[(3R)-1-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129062444 |
| Molecular Formula | C25H27ClN6 |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 6-[2-(3-chlorophenyl)ethynyl]-N-[(3R)-1-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=C(/C=C/CN(C)C)N1CC[C@@H](Nc2ncnc3[nH]c(C#Cc4cccc(Cl)c4)cc23)C1 |
| InChI | InChI=1S/C25H27ClN6/c1-18(6-5-12-31(2)3)32-13-11-22(16-32)30-25-23-15-21(29-24(23)27-17-28-25)10-9-19-7-4-8-20(26)14-19/h4-8,14-15,17,22H,1,11-13,16H2,2-3H3,(H2,27,28,29,30)/b6-5+/t22-/m1/s1 |
| InChIKey | QJWJQJFYDLGSGD-IOUFHMPJSA-N |
| XLogP | 4.13 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|