C34H32ClF5N6O3 — CID 129064717
4-chloro-2-[2,6-difluoro-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 129064717) has the molecular formula C34H32ClF5N6O3 and a molecular weight of 703.11 g/mol. Its IUPAC name is 4-chloro-2-[2,6-difluoro-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 4-chloro-2-[2,6-difluoro-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 129064717 |
| Molecular Formula | C34H32ClF5N6O3 |
| Molecular Weight | 703.11 g/mol |
| Exact Mass | 702.21 |
| IUPAC Name | 4-chloro-2-[2,6-difluoro-4-[[5-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]-2-pyridinyl]amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)cc(Nc5ccc(N6CCN(CCC(F)(F)F)CC6)cn5)cc4F)cc(Cl)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C34H32ClF5N6O3/c1-48-23-5-3-20(29(15-23)49-2)18-46-19-28-31(33(46)47)24(35)16-27(43-28)32-25(36)13-21(14-26(32)37)42-30-6-4-22(17-41-30)45-11-9-44(10-12-45)8-7-34(38,39)40/h3-6,13-17H,7-12,18-19H2,1-2H3,(H,41,42) |
| InChIKey | XFJSPHPLTNFKQP-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.11 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |