C38H46FN7O5 — CID 129064799
[2-[5-[[5-[2-ethoxyethyl-[2-(methylamino)ethyl]amino]-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-4-fluoro-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate (PubChem CID 129064799) has the molecular formula C38H46FN7O5 and a molecular weight of 699.83 g/mol. Its IUPAC name is [2-[5-[[5-[2-ethoxyethyl-[2-(methylamino)ethyl]amino]-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-4-fluoro-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate.
| Compound Name | [2-[5-[[5-[2-ethoxyethyl-[2-(methylamino)ethyl]amino]-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-4-fluoro-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 129064799 |
| Molecular Formula | C38H46FN7O5 |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 699.35 |
| IUPAC Name | [2-[5-[[5-[2-ethoxyethyl-[2-(methylamino)ethyl]amino]-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]-4-fluoro-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate |
| SMILES | CCOCCN(CCNC)c1ccc(Nc2cc(-c3cc(F)cc(N4CCn5c(cc6c5CCCC6)C4=O)c3COC(C)=O)cn(C)c2=O)nc1 |
| InChI | InChI=1S/C38H46FN7O5/c1-5-50-17-16-44(13-12-40-3)29-10-11-36(41-22-29)42-32-18-27(23-43(4)37(32)48)30-20-28(39)21-34(31(30)24-51-25(2)47)46-15-14-45-33-9-7-6-8-26(33)19-35(45)38(46)49/h10-11,18-23,40H,5-9,12-17,24H2,1-4H3,(H,41,42) |
| InChIKey | WFOPYCXGKMXCPS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|