About (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide
(2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide (PubChem CID 129065660) has the molecular formula C6H9NS2
and a molecular weight of 159.28 g/mol. Its IUPAC name is (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide.
Molecular Properties
| Compound Name | (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide |
| PubChem CID | 129065660 |
| Molecular Formula | C6H9NS2 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide |
| SMILES | C=C(S)/C=C\C(=S)NC |
| InChI | InChI=1S/C6H9NS2/c1-5(8)3-4-6(9)7-2/h3-4,8H,1H2,2H3,(H,7,9)/b4-3- |
| InChIKey | RQILRRUZUIDBNE-ARJAWSKDSA-N |
| XLogP | 1.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide?
The IUPAC name of (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide (CID 129065660) is (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide.
What is the SMILES notation for (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide?
The canonical SMILES for (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide is C=C(S)/C=C\C(=S)NC.
What is the InChIKey of (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide?
The InChIKey is RQILRRUZUIDBNE-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H9NS2/c1-5(8)3-4-6(9)7-2/h3-4,8H,1H2,2H3,(H,7,9)/b4-3-.
What are the key properties of (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide?
(2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide has a molecular weight of 159.28 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-methyl-4-sulfanylpenta-2,4-dienethioamide is sourced from PubChem (CID 129065660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).