C10H18N2 — CID 129065984
1-methyl-1-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]hydrazine (PubChem CID 129065984) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-methyl-1-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]hydrazine.
| Compound Name | 1-methyl-1-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]hydrazine |
|---|---|
| PubChem CID | 129065984 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-methyl-1-[(3E,5Z)-7-methylocta-3,5,7-trien-4-yl]hydrazine |
| SMILES | C=C(C)/C=C\C(=C/CC)N(C)N |
| InChI | InChI=1S/C10H18N2/c1-5-6-10(12(4)11)8-7-9(2)3/h6-8H,2,5,11H2,1,3-4H3/b8-7-,10-6+ |
| InChIKey | IFHUULWXMTYJLH-SDHBEMGISA-N |
| XLogP | 2.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|