C16H27NO — CID 129066203
(6E)-7,9,11-trimethyl-5-methyliminododeca-6,10-dien-4-one (PubChem CID 129066203) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (6E)-7,9,11-trimethyl-5-methyliminododeca-6,10-dien-4-one.
| Compound Name | (6E)-7,9,11-trimethyl-5-methyliminododeca-6,10-dien-4-one |
|---|---|
| PubChem CID | 129066203 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (6E)-7,9,11-trimethyl-5-methyliminododeca-6,10-dien-4-one |
| SMILES | CCCC(=O)C(/C=C(\C)CC(C)C=C(C)C)=N\C |
| InChI | InChI=1S/C16H27NO/c1-7-8-16(18)15(17-6)11-14(5)10-13(4)9-12(2)3/h9,11,13H,7-8,10H2,1-6H3/b14-11+,17-15- |
| InChIKey | UPDUMKVVSOJPAI-VDRZCLTPSA-N |
| XLogP | 4.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|