C20H34N2 — CID 129066207
(2Z,4Z)-N,6-dimethyl-N-[(Z)-4-methylideneoct-2-en-2-yl]-3-(methyliminomethyl)hepta-2,4-dien-4-amine (PubChem CID 129066207) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (2Z,4Z)-N,6-dimethyl-N-[(Z)-4-methylideneoct-2-en-2-yl]-3-(methyliminomethyl)hepta-2,4-dien-4-amine.
| Compound Name | (2Z,4Z)-N,6-dimethyl-N-[(Z)-4-methylideneoct-2-en-2-yl]-3-(methyliminomethyl)hepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 129066207 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (2Z,4Z)-N,6-dimethyl-N-[(Z)-4-methylideneoct-2-en-2-yl]-3-(methyliminomethyl)hepta-2,4-dien-4-amine |
| SMILES | C=C(/C=C(/C)N(C)C(=C\C(C)C)/C(=C/C)/C=N/C)CCCC |
| InChI | InChI=1S/C20H34N2/c1-9-11-12-17(5)14-18(6)22(8)20(13-16(3)4)19(10-2)15-21-7/h10,13-16H,5,9,11-12H2,1-4,6-8H3/b18-14-,19-10+,20-13-,21-15+ |
| InChIKey | XXYWBOOOVRUDNM-XDRIVZBXSA-N |
| XLogP | 5.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|