C17H29F2N — CID 129066317
N-[(E)-9,9-difluoro-2,4-dimethyl-6-methylidenedec-4-en-2-yl]butan-2-imine (PubChem CID 129066317) has the molecular formula C17H29F2N and a molecular weight of 285.42 g/mol. Its IUPAC name is N-[(E)-9,9-difluoro-2,4-dimethyl-6-methylidenedec-4-en-2-yl]butan-2-imine.
| Compound Name | N-[(E)-9,9-difluoro-2,4-dimethyl-6-methylidenedec-4-en-2-yl]butan-2-imine |
|---|---|
| PubChem CID | 129066317 |
| Molecular Formula | C17H29F2N |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | N-[(E)-9,9-difluoro-2,4-dimethyl-6-methylidenedec-4-en-2-yl]butan-2-imine |
| SMILES | C=C(/C=C(\C)CC(C)(C)/N=C(\C)CC)CCC(C)(F)F |
| InChI | InChI=1S/C17H29F2N/c1-8-15(4)20-16(5,6)12-14(3)11-13(2)9-10-17(7,18)19/h11H,2,8-10,12H2,1,3-7H3/b14-11+,20-15+ |
| InChIKey | OTOPUWRCLJAJRQ-LPCVSTDKSA-N |
| XLogP | 5.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|