About 5-(2-methylpropyl)-1,4-oxazepane
5-(2-methylpropyl)-1,4-oxazepane (PubChem CID 129066958) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 5-(2-methylpropyl)-1,4-oxazepane |
| PubChem CID | 129066958 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 5-(2-methylpropyl)-1,4-oxazepane |
| SMILES | CC(C)CC1CCOCCN1 |
| InChI | InChI=1S/C9H19NO/c1-8(2)7-9-3-5-11-6-4-10-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | QCSHXTSDGXXHQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-methylpropyl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpropyl)-1,4-oxazepane?
The IUPAC name of 5-(2-methylpropyl)-1,4-oxazepane (CID 129066958) is 5-(2-methylpropyl)-1,4-oxazepane.
What is the SMILES notation for 5-(2-methylpropyl)-1,4-oxazepane?
The canonical SMILES for 5-(2-methylpropyl)-1,4-oxazepane is CC(C)CC1CCOCCN1.
What is the InChIKey of 5-(2-methylpropyl)-1,4-oxazepane?
The InChIKey is QCSHXTSDGXXHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-8(2)7-9-3-5-11-6-4-10-9/h8-10H,3-7H2,1-2H3.
What are the key properties of 5-(2-methylpropyl)-1,4-oxazepane?
5-(2-methylpropyl)-1,4-oxazepane has a molecular weight of 157.26 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpropyl)-1,4-oxazepane is sourced from PubChem (CID 129066958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).