About tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate
tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate (PubChem CID 129067369) has the molecular formula C12H18N2O5
and a molecular weight of 270.28 g/mol. Its IUPAC name is tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate |
| PubChem CID | 129067369 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2nc(C(O)O)co2)C1 |
| InChI | InChI=1S/C12H18N2O5/c1-12(2,3)19-11(17)14-4-7(5-14)9-13-8(6-18-9)10(15)16/h6-7,10,15-16H,4-5H2,1-3H3 |
| InChIKey | WRYKBKAWFVTERN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate (CID 129067369) is tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate is CC(C)(C)OC(=O)N1CC(c2nc(C(O)O)co2)C1.
What is the InChIKey of tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate?
The InChIKey is WRYKBKAWFVTERN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O5/c1-12(2,3)19-11(17)14-4-7(5-14)9-13-8(6-18-9)10(15)16/h6-7,10,15-16H,4-5H2,1-3H3.
What are the key properties of tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate?
tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate has a molecular weight of 270.28 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[4-(dihydroxymethyl)-1,3-oxazol-2-yl]azetidine-1-carboxylate is sourced from PubChem (CID 129067369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).