C34H47NO3 — CID 129067430
(2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-(3-methylbut-2-enoxy)-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide (PubChem CID 129067430) has the molecular formula C34H47NO3 and a molecular weight of 517.75 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-(3-methylbut-2-enoxy)-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-(3-methylbut-2-enoxy)-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 129067430 |
| Molecular Formula | C34H47NO3 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-(3-methylbut-2-enoxy)-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
| SMILES | CC(C)=CCOC1=C(C)C2=CC=C3[C@@](C)(CC[C@@]4(C)[C@@H]5C[C@](C)(C(N)=O)CC[C@]5(C)CC[C@]34C)C2=CC1=O |
| InChI | InChI=1S/C34H47NO3/c1-21(2)11-18-38-28-22(3)23-9-10-26-32(6,24(23)19-25(28)36)15-17-34(8)27-20-31(5,29(35)37)13-12-30(27,4)14-16-33(26,34)7/h9-11,19,27H,12-18,20H2,1-8H3,(H2,35,37)/t27-,30-,31-,32+,33-,34+/m1/s1 |
| InChIKey | SRNNYHOACVSHMS-SAQIBKBSSA-N |
| XLogP | 7.52 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|