C18H31N — CID 129067726
2,2-dimethyl-5-(2,4,4,5-tetramethylhexan-2-yl)azepine (PubChem CID 129067726) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2,4,4,5-tetramethylhexan-2-yl)azepine.
| Compound Name | 2,2-dimethyl-5-(2,4,4,5-tetramethylhexan-2-yl)azepine |
|---|---|
| PubChem CID | 129067726 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2,2-dimethyl-5-(2,4,4,5-tetramethylhexan-2-yl)azepine |
| SMILES | CC(C)C(C)(C)CC(C)(C)C1=CC=NC(C)(C)C=C1 |
| InChI | InChI=1S/C18H31N/c1-14(2)16(3,4)13-17(5,6)15-9-11-18(7,8)19-12-10-15/h9-12,14H,13H2,1-8H3 |
| InChIKey | OKKHNXZAHYKMIQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |