C15H17N3 — CID 129067767
(3S,8R)-2,3,7,8-tetramethyl-3,8-dihydropyrido[2,3-b][1,8]naphthyridine (PubChem CID 129067767) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is (3S,8R)-2,3,7,8-tetramethyl-3,8-dihydropyrido[2,3-b][1,8]naphthyridine.
| Compound Name | (3S,8R)-2,3,7,8-tetramethyl-3,8-dihydropyrido[2,3-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 129067767 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | (3S,8R)-2,3,7,8-tetramethyl-3,8-dihydropyrido[2,3-b][1,8]naphthyridine |
| SMILES | CC1=Cc2cc3c(nc2=N[C@@H]1C)N=C(C)[C@@H](C)C=3 |
| InChI | InChI=1S/C15H17N3/c1-8-5-12-7-13-6-9(2)11(4)17-15(13)18-14(12)16-10(8)3/h5-8,11H,1-4H3/t8-,11+/m0/s1 |
| InChIKey | BEOSEVLKSYIUHZ-GZMMTYOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |