About (1-methylcyclobutyl) butanoate
(1-methylcyclobutyl) butanoate (PubChem CID 129067897) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is (1-methylcyclobutyl) butanoate.
Molecular Properties
| Compound Name | (1-methylcyclobutyl) butanoate |
| PubChem CID | 129067897 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (1-methylcyclobutyl) butanoate |
| SMILES | CCCC(=O)OC1(C)CCC1 |
| InChI | InChI=1S/C9H16O2/c1-3-5-8(10)11-9(2)6-4-7-9/h3-7H2,1-2H3 |
| InChIKey | MUJHJPPXYFJWOX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclobutyl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclobutyl) butanoate?
The IUPAC name of (1-methylcyclobutyl) butanoate (CID 129067897) is (1-methylcyclobutyl) butanoate.
What is the SMILES notation for (1-methylcyclobutyl) butanoate?
The canonical SMILES for (1-methylcyclobutyl) butanoate is CCCC(=O)OC1(C)CCC1.
What is the InChIKey of (1-methylcyclobutyl) butanoate?
The InChIKey is MUJHJPPXYFJWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-5-8(10)11-9(2)6-4-7-9/h3-7H2,1-2H3.
What are the key properties of (1-methylcyclobutyl) butanoate?
(1-methylcyclobutyl) butanoate has a molecular weight of 156.22 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclobutyl) butanoate is sourced from PubChem (CID 129067897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).