About 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine
3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine (PubChem CID 129068022) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine |
| PubChem CID | 129068022 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine |
| SMILES | C=C(CC)NC(C(=C)C(C)C)C(C)CN |
| InChI | InChI=1S/C13H26N2/c1-7-11(5)15-13(10(4)8-14)12(6)9(2)3/h9-10,13,15H,5-8,14H2,1-4H3 |
| InChIKey | OWGJYINBTUPCNQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine?
The IUPAC name of 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine (CID 129068022) is 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine.
What is the SMILES notation for 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine?
The canonical SMILES for 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine is C=C(CC)NC(C(=C)C(C)C)C(C)CN.
What is the InChIKey of 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine?
The InChIKey is OWGJYINBTUPCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-7-11(5)15-13(10(4)8-14)12(6)9(2)3/h9-10,13,15H,5-8,14H2,1-4H3.
What are the key properties of 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine?
3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine has a molecular weight of 210.36 g/mol, XLogP of 2.68, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-but-1-en-2-yl-2,5-dimethyl-4-methylidenehexane-1,3-diamine is sourced from PubChem (CID 129068022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).