About 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one
1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one (PubChem CID 129068034) has the molecular formula C19H36FNO
and a molecular weight of 313.50 g/mol. Its IUPAC name is 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one.
Molecular Properties
| Compound Name | 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one |
| PubChem CID | 129068034 |
| Molecular Formula | C19H36FNO |
| Molecular Weight | 313.50 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one |
| SMILES | CCCCCCCC(CCCCCC)C(=O)[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C19H36FNO/c1-3-5-7-9-11-13-16(12-10-8-6-4-2)19(22)18-14-17(20)15-21-18/h16-18,21H,3-15H2,1-2H3/t16?,17-,18-/m0/s1 |
| InChIKey | MRAIXDQUHILSKR-FQECFTEESA-N |
| XLogP | 5.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one?
The IUPAC name of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one (CID 129068034) is 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one.
What is the SMILES notation for 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one?
The canonical SMILES for 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one is CCCCCCCC(CCCCCC)C(=O)[C@@H]1C[C@H](F)CN1.
What is the InChIKey of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one?
The InChIKey is MRAIXDQUHILSKR-FQECFTEESA-N. The full InChI is InChI=1S/C19H36FNO/c1-3-5-7-9-11-13-16(12-10-8-6-4-2)19(22)18-14-17(20)15-21-18/h16-18,21H,3-15H2,1-2H3/t16?,17-,18-/m0/s1.
What are the key properties of 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one?
1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one has a molecular weight of 313.50 g/mol, XLogP of 5.20, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4S)-4-fluoropyrrolidin-2-yl]-2-hexylnonan-1-one is sourced from PubChem (CID 129068034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).