About methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate
methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate (PubChem CID 129068844) has the molecular formula C25H18ClF2NO4
and a molecular weight of 469.87 g/mol. Its IUPAC name is methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate |
| PubChem CID | 129068844 |
| Molecular Formula | C25H18ClF2NO4 |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1c(C=O)cn2Cc1cc(Cl)ccc1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C25H18ClF2NO4/c1-32-25(31)20-3-2-4-22-24(20)17(13-30)12-29(22)11-16-9-18(26)6-8-23(16)33-14-15-5-7-19(27)10-21(15)28/h2-10,12-13H,11,14H2,1H3 |
| InChIKey | MHKOGVDYNDRALF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate?
The IUPAC name of methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate (CID 129068844) is methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate.
What is the SMILES notation for methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate?
The canonical SMILES for methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate is COC(=O)c1cccc2c1c(C=O)cn2Cc1cc(Cl)ccc1OCc1ccc(F)cc1F.
What is the InChIKey of methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate?
The InChIKey is MHKOGVDYNDRALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18ClF2NO4/c1-32-25(31)20-3-2-4-22-24(20)17(13-30)12-29(22)11-16-9-18(26)6-8-23(16)33-14-15-5-7-19(27)10-21(15)28/h2-10,12-13H,11,14H2,1H3.
What are the key properties of methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate?
methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate has a molecular weight of 469.87 g/mol, XLogP of 5.80, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methyl]-3-formylindole-4-carboxylate is sourced from PubChem (CID 129068844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).