C40H75NO — CID 129069273
(11Z,14Z)-2-(1-aminoethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol (PubChem CID 129069273) has the molecular formula C40H75NO and a molecular weight of 586.05 g/mol. Its IUPAC name is (11Z,14Z)-2-(1-aminoethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol.
| Compound Name | (11Z,14Z)-2-(1-aminoethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol |
|---|---|
| PubChem CID | 129069273 |
| Molecular Formula | C40H75NO |
| Molecular Weight | 586.05 g/mol |
| Exact Mass | 585.58 |
| IUPAC Name | (11Z,14Z)-2-(1-aminoethyl)-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dien-1-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CO)(CCCCCCCC/C=C\C/C=C\CCCCC)C(C)N |
| InChI | InChI=1S/C40H75NO/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40(38-42,39(3)41)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,39,42H,4-11,16-17,22-38,41H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | MVVFPFICDOKRBD-QYCRHRGJSA-N |
| XLogP | 12.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.05 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|