C42H77NO — CID 129069308
3-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]propan-1-ol (PubChem CID 129069308) has the molecular formula C42H77NO and a molecular weight of 612.08 g/mol. Its IUPAC name is 3-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]propan-1-ol.
| Compound Name | 3-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 129069308 |
| Molecular Formula | C42H77NO |
| Molecular Weight | 612.08 g/mol |
| Exact Mass | 611.60 |
| IUPAC Name | 3-[3,3-bis[(9Z,12Z)-octadeca-9,12-dienyl]azetidin-1-yl]propan-1-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)CN(CCCO)C1 |
| InChI | InChI=1S/C42H77NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-42(40-43(41-42)38-35-39-44)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,44H,3-10,15-16,21-41H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | RQHZGTCLPKRLLA-MAZCIEHSSA-N |
| XLogP | 13.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.08 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|