C13H15F6N2+ — CID 129069442
1,3,4,6-tetramethyl-2,5-bis(trifluoromethyl)-5,6-dihydrobenzimidazol-3-ium (PubChem CID 129069442) has the molecular formula C13H15F6N2+ and a molecular weight of 313.27 g/mol. Its IUPAC name is 1,3,4,6-tetramethyl-2,5-bis(trifluoromethyl)-5,6-dihydrobenzimidazol-3-ium.
| Compound Name | 1,3,4,6-tetramethyl-2,5-bis(trifluoromethyl)-5,6-dihydrobenzimidazol-3-ium |
|---|---|
| PubChem CID | 129069442 |
| Molecular Formula | C13H15F6N2+ |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1,3,4,6-tetramethyl-2,5-bis(trifluoromethyl)-5,6-dihydrobenzimidazol-3-ium |
| SMILES | CC1=c2c(n(C)c(C(F)(F)F)[n+]2C)=CC(C)C1C(F)(F)F |
| InChI | InChI=1S/C13H15F6N2/c1-6-5-8-10(7(2)9(6)12(14,15)16)21(4)11(20(8)3)13(17,18)19/h5-6,9H,1-4H3/q+1 |
| InChIKey | FFQUBCODDQRGHK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|