C12H14F4N2 — CID 129069446
1,3,5,6-tetramethyl-2-(trifluoromethyl)benzimidazol-3-ium fluoride (PubChem CID 129069446) has the molecular formula C12H14F4N2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 1,3,5,6-tetramethyl-2-(trifluoromethyl)benzimidazol-3-ium fluoride.
| Compound Name | 1,3,5,6-tetramethyl-2-(trifluoromethyl)benzimidazol-3-ium fluoride |
|---|---|
| PubChem CID | 129069446 |
| Molecular Formula | C12H14F4N2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1,3,5,6-tetramethyl-2-(trifluoromethyl)benzimidazol-3-ium fluoride |
| SMILES | Cc1cc2c(cc1C)[n+](C)c(C(F)(F)F)n2C.[F-] |
| InChI | InChI=1S/C12H14F3N2.FH/c1-7-5-9-10(6-8(7)2)17(4)11(16(9)3)12(13,14)15;/h5-6H,1-4H3;1H/q+1;/p-1 |
| InChIKey | ITBRJHPLBWABCX-UHFFFAOYSA-M |
| XLogP | -0.36 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|