C11H10F5IN2 — CID 129069540
1,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-3-ium iodide (PubChem CID 129069540) has the molecular formula C11H10F5IN2 and a molecular weight of 392.11 g/mol. Its IUPAC name is 1,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-3-ium iodide.
| Compound Name | 1,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-3-ium iodide |
|---|---|
| PubChem CID | 129069540 |
| Molecular Formula | C11H10F5IN2 |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 1,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)benzimidazol-3-ium iodide |
| SMILES | Cn1c(C(F)(F)C(F)(F)F)[n+](C)c2ccccc21.[I-] |
| InChI | InChI=1S/C11H10F5N2.HI/c1-17-7-5-3-4-6-8(7)18(2)9(17)10(12,13)11(14,15)16;/h3-6H,1-2H3;1H/q+1;/p-1 |
| InChIKey | MHSJWFULZGDJFK-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|