About 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid
3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid (PubChem CID 129070067) has the molecular formula C13H19F3O3S
and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid |
| PubChem CID | 129070067 |
| Molecular Formula | C13H19F3O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)CC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H19F3O3S/c14-12(13(15,16)20(17,18)19)6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-12H,1-6H2,(H,17,18,19) |
| InChIKey | LMBAVYJEFCYZNL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid?
The IUPAC name of 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid (CID 129070067) is 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid.
What is the SMILES notation for 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid?
The canonical SMILES for 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid is O=S(=O)(O)C(F)(F)C(F)CC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid?
The InChIKey is LMBAVYJEFCYZNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3O3S/c14-12(13(15,16)20(17,18)19)6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-12H,1-6H2,(H,17,18,19).
What are the key properties of 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid?
3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid has a molecular weight of 312.35 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-adamantyl)-1,1,2-trifluoropropane-1-sulfonic acid is sourced from PubChem (CID 129070067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).