C13H18F4O3S — CID 129070071
3-(2-adamantyl)-1,1,2,2-tetrafluoropropane-1-sulfonic acid (PubChem CID 129070071) has the molecular formula C13H18F4O3S and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-(2-adamantyl)-1,1,2,2-tetrafluoropropane-1-sulfonic acid.
| Compound Name | 3-(2-adamantyl)-1,1,2,2-tetrafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070071 |
| Molecular Formula | C13H18F4O3S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-(2-adamantyl)-1,1,2,2-tetrafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)CC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H18F4O3S/c14-12(15,13(16,17)21(18,19)20)6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-11H,1-6H2,(H,18,19,20) |
| InChIKey | MMNBIMYKFAUYEF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|