C10H4BrF7O5S — CID 129070093
2-(4-bromo-2,6-difluorobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 129070093) has the molecular formula C10H4BrF7O5S and a molecular weight of 449.09 g/mol. Its IUPAC name is 2-(4-bromo-2,6-difluorobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-(4-bromo-2,6-difluorobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070093 |
| Molecular Formula | C10H4BrF7O5S |
| Molecular Weight | 449.09 g/mol |
| Exact Mass | 447.89 |
| IUPAC Name | 2-(4-bromo-2,6-difluorobenzoyl)oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H4BrF7O5S/c11-3-1-4(12)6(5(13)2-3)7(19)23-8(9(14,15)16)10(17,18)24(20,21)22/h1-2,8H,(H,20,21,22) |
| InChIKey | VCCZAHFYZAPCCX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.09 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|