C12H11F5O4S — CID 129070339
2-(2,3-dihydro-1H-inden-2-yloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 129070339) has the molecular formula C12H11F5O4S and a molecular weight of 346.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-yloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-yloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070339 |
| Molecular Formula | C12H11F5O4S |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-yloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(OC1Cc2ccccc2C1)C(F)(F)F |
| InChI | InChI=1S/C12H11F5O4S/c13-11(14,15)10(12(16,17)22(18,19)20)21-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2,(H,18,19,20) |
| InChIKey | HDKDULAQPFKOSX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|