About 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one
5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one (PubChem CID 129070405) has the molecular formula C19H22N4OS
and a molecular weight of 354.48 g/mol. Its IUPAC name is 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one |
| PubChem CID | 129070405 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ccc3ncc(SNC4CCCC4)n3c2)cn(C)c1=O |
| InChI | InChI=1S/C19H22N4OS/c1-13-9-15(11-22(2)19(13)24)14-7-8-17-20-10-18(23(17)12-14)25-21-16-5-3-4-6-16/h7-12,16,21H,3-6H2,1-2H3 |
| InChIKey | LXMJBDQCMRJCIO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one?
The IUPAC name of 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one (CID 129070405) is 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one.
What is the SMILES notation for 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one?
The canonical SMILES for 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one is Cc1cc(-c2ccc3ncc(SNC4CCCC4)n3c2)cn(C)c1=O.
What is the InChIKey of 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one?
The InChIKey is LXMJBDQCMRJCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4OS/c1-13-9-15(11-22(2)19(13)24)14-7-8-17-20-10-18(23(17)12-14)25-21-16-5-3-4-6-16/h7-12,16,21H,3-6H2,1-2H3.
What are the key properties of 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one?
5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one has a molecular weight of 354.48 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(cyclopentylamino)sulfanylimidazo[1,2-a]pyridin-6-yl]-1,3-dimethylpyridin-2-one is sourced from PubChem (CID 129070405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).