About [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate
[(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate (PubChem CID 129071112) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate.
Molecular Properties
| Compound Name | [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate |
| PubChem CID | 129071112 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate |
| SMILES | C=CC(CC)C(C)(C(C)C)C(/C=C\C)OC(C)=O |
| InChI | InChI=1S/C16H28O2/c1-8-11-15(18-13(6)17)16(7,12(4)5)14(9-2)10-3/h8-9,11-12,14-15H,2,10H2,1,3-7H3/b11-8- |
| InChIKey | VAKNXHNQIVESQB-FLIBITNWSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate?
The IUPAC name of [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate (CID 129071112) is [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate.
What is the SMILES notation for [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate?
The canonical SMILES for [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate is C=CC(CC)C(C)(C(C)C)C(/C=C\C)OC(C)=O.
What is the InChIKey of [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate?
The InChIKey is VAKNXHNQIVESQB-FLIBITNWSA-N. The full InChI is InChI=1S/C16H28O2/c1-8-11-15(18-13(6)17)16(7,12(4)5)14(9-2)10-3/h8-9,11-12,14-15H,2,10H2,1,3-7H3/b11-8-.
What are the key properties of [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate?
[(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate has a molecular weight of 252.40 g/mol, XLogP of 4.37, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-6-ethyl-5-methyl-5-propan-2-ylocta-2,7-dien-4-yl] acetate is sourced from PubChem (CID 129071112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).