C21H28N6O2 — CID 129071745
5-[[6-amino-5-(3-aminopropoxy)pyrimidin-4-yl]amino]-7-methylspiro[2H-isoindole-3,1'-cyclohexane]-1-one (PubChem CID 129071745) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 5-[[6-amino-5-(3-aminopropoxy)pyrimidin-4-yl]amino]-7-methylspiro[2H-isoindole-3,1'-cyclohexane]-1-one.
| Compound Name | 5-[[6-amino-5-(3-aminopropoxy)pyrimidin-4-yl]amino]-7-methylspiro[2H-isoindole-3,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 129071745 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 5-[[6-amino-5-(3-aminopropoxy)pyrimidin-4-yl]amino]-7-methylspiro[2H-isoindole-3,1'-cyclohexane]-1-one |
| SMILES | Cc1cc(Nc2ncnc(N)c2OCCCN)cc2c1C(=O)NC21CCCCC1 |
| InChI | InChI=1S/C21H28N6O2/c1-13-10-14(26-19-17(29-9-5-8-22)18(23)24-12-25-19)11-15-16(13)20(28)27-21(15)6-3-2-4-7-21/h10-12H,2-9,22H2,1H3,(H,27,28)(H3,23,24,25,26) |
| InChIKey | IJONOPZMFPSMIU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|