C9H12N4O4 — CID 129072489
(3R,4S)-3-azido-4-prop-2-enylpyrrolidine-1,3-dicarboxylic acid (PubChem CID 129072489) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is (3R,4S)-3-azido-4-prop-2-enylpyrrolidine-1,3-dicarboxylic acid.
| Compound Name | (3R,4S)-3-azido-4-prop-2-enylpyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 129072489 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (3R,4S)-3-azido-4-prop-2-enylpyrrolidine-1,3-dicarboxylic acid |
| SMILES | C=CC[C@H]1CN(C(=O)O)C[C@@]1(N=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C9H12N4O4/c1-2-3-6-4-13(8(16)17)5-9(6,7(14)15)11-12-10/h2,6H,1,3-5H2,(H,14,15)(H,16,17)/t6-,9-/m0/s1 |
| InChIKey | UNWSZXGIWYQADW-RCOVLWMOSA-N |
| XLogP | 1.31 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|