C20H25FN6O — CID 129073113
3-[3-fluoro-4-(3-piperidin-4-ylpropoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 129073113) has the molecular formula C20H25FN6O and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-[3-fluoro-4-(3-piperidin-4-ylpropoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 3-[3-fluoro-4-(3-piperidin-4-ylpropoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 129073113 |
| Molecular Formula | C20H25FN6O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 3-[3-fluoro-4-(3-piperidin-4-ylpropoxy)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | Cn1nc(-c2ccc(OCCCC3CCNCC3)c(F)c2)c2cnc(N)nc21 |
| InChI | InChI=1S/C20H25FN6O/c1-27-19-15(12-24-20(22)25-19)18(26-27)14-4-5-17(16(21)11-14)28-10-2-3-13-6-8-23-9-7-13/h4-5,11-13,23H,2-3,6-10H2,1H3,(H2,22,24,25) |
| InChIKey | YSLSSCOTQRLGCR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|