C36H46N8O5 — CID 129073135
2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 129073135) has the molecular formula C36H46N8O5 and a molecular weight of 670.82 g/mol. Its IUPAC name is 2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129073135 |
| Molecular Formula | C36H46N8O5 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | 2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3ccc(CN4CCN(CCOCCON5C(=O)c6ccccc6C5=O)CC4)cc3OC)c12 |
| InChI | InChI=1S/C36H46N8O5/c1-3-4-7-13-38-33-32-30(39-36(37)40-33)12-14-43(32)25-27-11-10-26(23-31(27)47-2)24-42-17-15-41(16-18-42)19-20-48-21-22-49-44-34(45)28-8-5-6-9-29(28)35(44)46/h5-6,8-12,14,23H,3-4,7,13,15-22,24-25H2,1-2H3,(H3,37,38,39,40) |
| InChIKey | UKRZQIBGIPDUGQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|